| Name | Calcium tartrate dihydrate |
| Synonyms | Calciumtartrat CALICIUMTARTRATE Calcium Tartrate L-Calciumtartrate Calcium tartrate dihydrate CALCIUM TARTRATE 2-HYDRATE L-(+)-calcium tartrate hydrate (+)-Calcium L-tartrate hydrate (+)-CALCIUM L-TARTRATE DIHYDRATE calcium 2,3-dihydroxybutanedioate (2R,3R)-2,3-Dihydroxybutanedioic acid calcium salt 2,3-dihydroxy-[ theta-( theta, theta)]-butanedioic aci calcium salt |
| CAS | 3164-34-9 |
| EINECS | 221-621-5 |
| InChI | InChI=1/C4H6O6.Ca/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 |
| Molecular Formula | C4H8CaO6 |
| Molar Mass | 192.18 |
| Density | 1.878[at 20℃] |
| Melting Point | decomposes [CRC10] |
| Specific Rotation(α) | [α]D20 +5.0~+8.0゜ (c=5, dil. HCl) |
| Water Solubility | g/100g H2O: 0.026 (0°C), 0.034 (20°C), 0.130 (80°C) [LAN05]; soluble dilute HCl, HNO3 [MER06] |
| Vapor Presure | 0Pa at 25℃ |
| Merck | 13,1714 |
| Use | Used in medicine and decorative materials |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| LogP | -3.6 at 20℃ |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | for medicine and decorative materials |